Dufrénite [ Ca0.5FeIIFeIII5(PO4)4(OH)6·2H2O ]
Image of Dufrénite
Material properties
| Search other databases | webmineral.com, mindat.org, rruf.info, mineralienatlas.de, Handbook of Mineralogy, American Mineralogist Crystal Structure Database |
| Crystal symmetry | Monoclinic, Point group 2/m, Space group C2/c (#15) |
| Tags | Hydrated , Hydroxide , Mineral, Orthophosphate , Phosphate |
Composition
| Element | Atoms |
|---|---|
| P | 4 |
| H | 10 |
| O | 24 |
| Fe | 6 |
| Ca | 0.5 |
| Total: | 44.5 |
Specimens of Dufrénite
| Name | Owner | Materials | Image | Spectra | Techniques |
|---|