Epidote-(Sr) [ CaSr(Al2FeIII)[Si2O7][SiO4]O(OH) ]
Material properties
| Search other databases | webmineral.com, mindat.org, rruf.info, mineralienatlas.de, Handbook of Mineralogy, American Mineralogist Crystal Structure Database |
| Tags | Hydroxide , Mineral, Aluminosilicate |
Composition
| Element | Atoms |
|---|---|
| H | 1 |
| Ca | 1 |
| Al | 2 |
| Fe | 1 |
| Sr | 1 |
| Si | 3 |
| O | 13 |
| Total: | 22 |
Specimens of Epidote-(Sr)
| Name | Owner | Materials | Image | Spectra | Techniques |
|---|