Schorl [ NaFeII3Al6(Si6O18)(BO3)3(OH)3(OH) ]
Material properties
| Formula | NaFeII3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Abbreviation | Srl |
| Classifications | Minerals containing BO3, Tourmaline, Minerals containing OH |
| Luminescence emitter | BO3 |
| IMA Status | Approved/renamed (IMA 2007 s.p.) |
| Search other databases | webmineral.com, mindat.org, rruf.info, mineralienatlas.de, Handbook of Mineralogy, American Mineralogist Crystal Structure Database |
| Crystal symmetry | Trigonal, Point group 3m, Space group R3m (#160) |
| Tags | Borate , Hydroxide , Mineral, Aluminosilicate |
Composition
| Element | Atoms |
|---|---|
| Na | 1 |
| Si | 6 |
| H | 4 |
| Fe | 3 |
| B | 3 |
| O | 31 |
| Al | 6 |
| Total: | 54 |
Specimens of Schorl
| Name | Owner | Materials | Phase purity | Image |
|---|---|---|---|---|
| MES003 Schorl | CSIRO | Schorl (100.0%) | 100.0 | |
| M1357 Schorl / Muscovite | CSIRO | Gibbsite, Goethite, Muscovite-2M1, Quartz, Schorl (71.5%) | 71.5 | |
| M2333 Schorl / Topaz / Quartz | CSIRO | Cassiterite, Goethite, Quartz, Schorl (63.1%), Topaz | 63.1 | |
| M1366 Quartz / Schorl | CSIRO | Quartz, Schorl (42.9%) | 42.9 |
